C25H42O7 — CID 102375874
(2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[[(1S,4R,5S,7R,9R,10R,13R,14R)-14-hydroxy-5,9,14-trimethyl-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]oxane-3,4,5-triol (PubChem CID 102375874) has the molecular formula C25H42O7 and a molecular weight of 454.60 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[[(1S,4R,5S,7R,9R,10R,13R,14R)-14-hydroxy-5,9,14-trimethyl-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[[(1S,4R,5S,7R,9R,10R,13R,14R)-14-hydroxy-5,9,14-trimethyl-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102375874 |
| Molecular Formula | C25H42O7 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[[(1S,4R,5S,7R,9R,10R,13R,14R)-14-hydroxy-5,9,14-trimethyl-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]oxane-3,4,5-triol |
| SMILES | C[C@H]1C[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)C[C@]2(C)[C@@H]1CC[C@@]13C[C@@H](CC[C@H]12)[C@](C)(O)C3 |
| InChI | InChI=1S/C25H42O7/c1-13-8-15(31-22-21(29)20(28)19(27)17(11-26)32-22)10-23(2)16(13)6-7-25-9-14(4-5-18(23)25)24(3,30)12-25/h13-22,26-30H,4-12H2,1-3H3/t13-,14+,15+,16+,17+,18-,19+,20+,21+,22+,23+,24+,25-/m0/s1 |
| InChIKey | FZLUKQAFUTTYCE-ZJLBJAIPSA-N |
| XLogP | 1.58 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|