C26H42O10 — CID 162905924
5,5,14-trimethyl-9-methylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,8]hexadecane-3,4,7,14-tetrol (PubChem CID 162905924) has the molecular formula C26H42O10 and a molecular weight of 514.61 g/mol. Its IUPAC name is 5,5,14-trimethyl-9-methylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,8]hexadecane-3,4,7,14-tetrol.
| Compound Name | 5,5,14-trimethyl-9-methylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,8]hexadecane-3,4,7,14-tetrol |
|---|---|
| PubChem CID | 162905924 |
| Molecular Formula | C26H42O10 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 5,5,14-trimethyl-9-methylidene-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytetracyclo[11.2.1.01,10.04,8]hexadecane-3,4,7,14-tetrol |
| SMILES | C=C1C2CCC3CC2(CC(O)C2(O)C1C(O)C(OC1OC(CO)C(O)C(O)C1O)C2(C)C)CC3(C)O |
| InChI | InChI=1S/C26H42O10/c1-11-13-6-5-12-7-25(13,10-24(12,4)33)8-15(28)26(34)16(11)18(30)21(23(26,2)3)36-22-20(32)19(31)17(29)14(9-27)35-22/h12-22,27-34H,1,5-10H2,2-4H3 |
| InChIKey | ZMBBDFIQIZOTQT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|