C25H28FN3O4 — CID 155543999
N-(1,3-benzodioxol-5-ylmethyl)-2-[5-fluoro-2-methyl-3-(2-morpholin-4-ylethyl)indol-1-yl]acetamide (PubChem CID 155543999) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[5-fluoro-2-methyl-3-(2-morpholin-4-ylethyl)indol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[5-fluoro-2-methyl-3-(2-morpholin-4-ylethyl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 155543999 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[5-fluoro-2-methyl-3-(2-morpholin-4-ylethyl)indol-1-yl]acetamide |
| SMILES | Cc1c(CCN2CCOCC2)c2cc(F)ccc2n1CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H28FN3O4/c1-17-20(6-7-28-8-10-31-11-9-28)21-13-19(26)3-4-22(21)29(17)15-25(30)27-14-18-2-5-23-24(12-18)33-16-32-23/h2-5,12-13H,6-11,14-16H2,1H3,(H,27,30) |
| InChIKey | KLCPOIODNVFWGG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|