C22H23FN4O5S — CID 155544585
3-(4-fluorophenyl)-N-[(1R)-1-[4-[2-(methoxyamino)-2-oxoethyl]sulfonylphenyl]ethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 155544585) has the molecular formula C22H23FN4O5S and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(1R)-1-[4-[2-(methoxyamino)-2-oxoethyl]sulfonylphenyl]ethyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(1R)-1-[4-[2-(methoxyamino)-2-oxoethyl]sulfonylphenyl]ethyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155544585 |
| Molecular Formula | C22H23FN4O5S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(1R)-1-[4-[2-(methoxyamino)-2-oxoethyl]sulfonylphenyl]ethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CONC(=O)CS(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc(-c3ccc(F)cc3)nn2C)cc1 |
| InChI | InChI=1S/C22H23FN4O5S/c1-14(15-6-10-18(11-7-15)33(30,31)13-21(28)26-32-3)24-22(29)20-12-19(25-27(20)2)16-4-8-17(23)9-5-16/h4-12,14H,13H2,1-3H3,(H,24,29)(H,26,28)/t14-/m1/s1 |
| InChIKey | XKIQODDZLGSGRG-CQSZACIVSA-N |
| XLogP | 2.17 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|