C20H22N6O — CID 155537379
N-[(1R)-1-[4-(diaminomethylideneamino)phenyl]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide (PubChem CID 155537379) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[(1R)-1-[4-(diaminomethylideneamino)phenyl]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide.
| Compound Name | N-[(1R)-1-[4-(diaminomethylideneamino)phenyl]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155537379 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[(1R)-1-[4-(diaminomethylideneamino)phenyl]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(-c2ccccc2)nn1C)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C20H22N6O/c1-13(14-8-10-16(11-9-14)24-20(21)22)23-19(27)18-12-17(25-26(18)2)15-6-4-3-5-7-15/h3-13H,1-2H3,(H,23,27)(H4,21,22,24)/t13-/m1/s1 |
| InChIKey | LEIXJHOCVLBLCX-CYBMUJFWSA-N |
| XLogP | 2.48 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|