C13H16N4O — CID 122171416
5-amino-1-methyl-N-(1-phenylethyl)pyrazole-3-carboxamide (PubChem CID 122171416) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-amino-1-methyl-N-(1-phenylethyl)pyrazole-3-carboxamide.
| Compound Name | 5-amino-1-methyl-N-(1-phenylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 122171416 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-amino-1-methyl-N-(1-phenylethyl)pyrazole-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(N)n(C)n1)c1ccccc1 |
| InChI | InChI=1S/C13H16N4O/c1-9(10-6-4-3-5-7-10)15-13(18)11-8-12(14)17(2)16-11/h3-9H,14H2,1-2H3,(H,15,18) |
| InChIKey | OOQFSFGQHWLERJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |