C14H15F2N3O2 — CID 136586319
5-(difluoromethyl)-N-[(1S)-1-(3-hydroxyphenyl)ethyl]-1-methylpyrazole-3-carboxamide (PubChem CID 136586319) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[(1S)-1-(3-hydroxyphenyl)ethyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-(difluoromethyl)-N-[(1S)-1-(3-hydroxyphenyl)ethyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136586319 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-(difluoromethyl)-N-[(1S)-1-(3-hydroxyphenyl)ethyl]-1-methylpyrazole-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(C(F)F)n(C)n1)c1cccc(O)c1 |
| InChI | InChI=1S/C14H15F2N3O2/c1-8(9-4-3-5-10(20)6-9)17-14(21)11-7-12(13(15)16)19(2)18-11/h3-8,13,20H,1-2H3,(H,17,21)/t8-/m0/s1 |
| InChIKey | XIXVFFWAGSIDFH-QMMMGPOBSA-N |
| XLogP | 2.55 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |