C23H17F6N3O5S — CID 155544728
4-[[2-[(4-fluorophenyl)sulfonyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetyl]-methylamino]-N-hydroxybenzamide (PubChem CID 155544728) has the molecular formula C23H17F6N3O5S and a molecular weight of 561.46 g/mol. Its IUPAC name is 4-[[2-[(4-fluorophenyl)sulfonyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetyl]-methylamino]-N-hydroxybenzamide.
| Compound Name | 4-[[2-[(4-fluorophenyl)sulfonyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetyl]-methylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 155544728 |
| Molecular Formula | C23H17F6N3O5S |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | 4-[[2-[(4-fluorophenyl)sulfonyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]acetyl]-methylamino]-N-hydroxybenzamide |
| SMILES | CN(C(=O)CN(Cc1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)c1ccc(F)cc1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C23H17F6N3O5S/c1-31(14-6-2-12(3-7-14)23(34)30-35)17(33)11-32(38(36,37)15-8-4-13(24)5-9-15)10-16-18(25)20(27)22(29)21(28)19(16)26/h2-9,35H,10-11H2,1H3,(H,30,34) |
| InChIKey | CNONRNROPLOWNM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|