C14H17ClN2OS — CID 155545584
5-chloro-2-(3-pyrrolidin-1-ylpropylsulfanyl)-1,3-benzoxazole (PubChem CID 155545584) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 5-chloro-2-(3-pyrrolidin-1-ylpropylsulfanyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(3-pyrrolidin-1-ylpropylsulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 155545584 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-chloro-2-(3-pyrrolidin-1-ylpropylsulfanyl)-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(SCCCN3CCCC3)nc2c1 |
| InChI | InChI=1S/C14H17ClN2OS/c15-11-4-5-13-12(10-11)16-14(18-13)19-9-3-8-17-6-1-2-7-17/h4-5,10H,1-3,6-9H2 |
| InChIKey | ZOIWRTIQDBEQGF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|