C16H18N4O8S — CID 155546483
ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyloxy]benzoate (PubChem CID 155546483) has the molecular formula C16H18N4O8S and a molecular weight of 426.41 g/mol. Its IUPAC name is ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyloxy]benzoate.
| Compound Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyloxy]benzoate |
|---|---|
| PubChem CID | 155546483 |
| Molecular Formula | C16H18N4O8S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyloxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OS(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C16H18N4O8S/c1-4-27-14(21)10-7-5-6-8-11(10)28-29(23,24)20-16(22)19-15-17-12(25-2)9-13(18-15)26-3/h5-9H,4H2,1-3H3,(H2,17,18,19,20,22) |
| InChIKey | WYLBKPYSGIUOPD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |