C24H16N4O3S — CID 155547483
N-(3-cyanophenyl)-4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidine-5-carboxamide (PubChem CID 155547483) has the molecular formula C24H16N4O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidine-5-carboxamide.
| Compound Name | N-(3-cyanophenyl)-4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155547483 |
| Molecular Formula | C24H16N4O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-(3-cyanophenyl)-4-hydroxy-6-oxo-1,3-diphenyl-2-sulfanylidenepyrimidine-5-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2c(O)n(-c3ccccc3)c(=S)n(-c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C24H16N4O3S/c25-15-16-8-7-9-17(14-16)26-21(29)20-22(30)27(18-10-3-1-4-11-18)24(32)28(23(20)31)19-12-5-2-6-13-19/h1-14,30H,(H,26,29) |
| InChIKey | ZLOSUTFQIDLZMJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|