C29H38N10O — CID 155547807
2-[4-[(4-methylpiperazin-1-yl)methyl]triazol-1-yl]-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzamide (PubChem CID 155547807) has the molecular formula C29H38N10O and a molecular weight of 542.69 g/mol. Its IUPAC name is 2-[4-[(4-methylpiperazin-1-yl)methyl]triazol-1-yl]-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzamide.
| Compound Name | 2-[4-[(4-methylpiperazin-1-yl)methyl]triazol-1-yl]-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzamide |
|---|---|
| PubChem CID | 155547807 |
| Molecular Formula | C29H38N10O |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 2-[4-[(4-methylpiperazin-1-yl)methyl]triazol-1-yl]-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzamide |
| SMILES | CN1CCN(Cc2cn(-c3ccccc3C(=O)NCCCCCCCn3cc(-c4cccnc4)nn3)nn2)CC1 |
| InChI | InChI=1S/C29H38N10O/c1-36-16-18-37(19-17-36)21-25-22-39(35-32-25)28-12-6-5-11-26(28)29(40)31-14-7-3-2-4-8-15-38-23-27(33-34-38)24-10-9-13-30-20-24/h5-6,9-13,20,22-23H,2-4,7-8,14-19,21H2,1H3,(H,31,40) |
| InChIKey | NOPNOYZVWMIJNN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|