C23H24N2O2 — CID 155549638
2-phenylethyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate (PubChem CID 155549638) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-phenylethyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate.
| Compound Name | 2-phenylethyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155549638 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-phenylethyl 4-[3-(6-methyl-2-pyridinyl)prop-2-ynylidene]piperidine-1-carboxylate |
| SMILES | Cc1cccc(C#CC=C2CCN(C(=O)OCCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H24N2O2/c1-19-7-5-11-22(24-19)12-6-10-21-13-16-25(17-14-21)23(26)27-18-15-20-8-3-2-4-9-20/h2-5,7-11H,13-18H2,1H3 |
| InChIKey | SBRRGTBDKMGSKA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|