C17H16ClN3O4S — CID 155550021
[3-[2-acetyl-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]phenyl] sulfamate (PubChem CID 155550021) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is [3-[2-acetyl-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]phenyl] sulfamate.
| Compound Name | [3-[2-acetyl-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 155550021 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [3-[2-acetyl-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]phenyl] sulfamate |
| SMILES | CC(=O)N1N=C(c2ccc(Cl)cc2)CC1c1cccc(OS(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H16ClN3O4S/c1-11(22)21-17(10-16(20-21)12-5-7-14(18)8-6-12)13-3-2-4-15(9-13)25-26(19,23)24/h2-9,17H,10H2,1H3,(H2,19,23,24) |
| InChIKey | JOJWCXZGPJMGIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |