C17H15Cl2N3O4S — CID 155527483
[4-[2-acetyl-3-(2,5-dichlorophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate (PubChem CID 155527483) has the molecular formula C17H15Cl2N3O4S and a molecular weight of 428.30 g/mol. Its IUPAC name is [4-[2-acetyl-3-(2,5-dichlorophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate.
| Compound Name | [4-[2-acetyl-3-(2,5-dichlorophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 155527483 |
| Molecular Formula | C17H15Cl2N3O4S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | [4-[2-acetyl-3-(2,5-dichlorophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
| SMILES | CC(=O)N1N=C(c2ccc(OS(N)(=O)=O)cc2)CC1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O4S/c1-10(23)22-17(14-8-12(18)4-7-15(14)19)9-16(21-22)11-2-5-13(6-3-11)26-27(20,24)25/h2-8,17H,9H2,1H3,(H2,20,24,25) |
| InChIKey | HJHPMKAERBOCJC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |