C18H19N3O4S — CID 155514970
[4-[2-acetyl-3-(4-methylphenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate (PubChem CID 155514970) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is [4-[2-acetyl-3-(4-methylphenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate.
| Compound Name | [4-[2-acetyl-3-(4-methylphenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 155514970 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [4-[2-acetyl-3-(4-methylphenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
| SMILES | CC(=O)N1N=C(c2ccc(OS(N)(=O)=O)cc2)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12-3-5-15(6-4-12)18-11-17(20-21(18)13(2)22)14-7-9-16(10-8-14)25-26(19,23)24/h3-10,18H,11H2,1-2H3,(H2,19,23,24) |
| InChIKey | DJHPJICVZYBURS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |