C17H16N4O6S — CID 155568045
[4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate (PubChem CID 155568045) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is [4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate.
| Compound Name | [4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 155568045 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl] sulfamate |
| SMILES | CC(=O)N1N=C(c2ccc(OS(N)(=O)=O)cc2)CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N4O6S/c1-11(22)20-17(13-2-6-14(7-3-13)21(23)24)10-16(19-20)12-4-8-15(9-5-12)27-28(18,25)26/h2-9,17H,10H2,1H3,(H2,18,25,26) |
| InChIKey | YOCHWMLSHMATRP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|