C20H18BrNO5S — CID 155551863
N-(3-bromo-5-methylphenyl)sulfonyl-2-(7-methoxynaphthalen-2-yl)oxyacetamide (PubChem CID 155551863) has the molecular formula C20H18BrNO5S and a molecular weight of 464.34 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)sulfonyl-2-(7-methoxynaphthalen-2-yl)oxyacetamide.
| Compound Name | N-(3-bromo-5-methylphenyl)sulfonyl-2-(7-methoxynaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 155551863 |
| Molecular Formula | C20H18BrNO5S |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)sulfonyl-2-(7-methoxynaphthalen-2-yl)oxyacetamide |
| SMILES | COc1ccc2ccc(OCC(=O)NS(=O)(=O)c3cc(C)cc(Br)c3)cc2c1 |
| InChI | InChI=1S/C20H18BrNO5S/c1-13-7-16(21)11-19(8-13)28(24,25)22-20(23)12-27-18-6-4-14-3-5-17(26-2)9-15(14)10-18/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | CLBZOGCIJMRQIE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |