C21H21NO3 — CID 7652726
N-(3,5-dimethylphenyl)-2-(7-methoxynaphthalen-2-yl)oxyacetamide (PubChem CID 7652726) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(7-methoxynaphthalen-2-yl)oxyacetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(7-methoxynaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 7652726 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(7-methoxynaphthalen-2-yl)oxyacetamide |
| SMILES | COc1ccc2ccc(OCC(=O)Nc3cc(C)cc(C)c3)cc2c1 |
| InChI | InChI=1S/C21H21NO3/c1-14-8-15(2)10-18(9-14)22-21(23)13-25-20-7-5-16-4-6-19(24-3)11-17(16)12-20/h4-12H,13H2,1-3H3,(H,22,23) |
| InChIKey | ZKCGUTQJUQLGFF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |