C17H16BClN4O3 — CID 155552083
[(1R)-2-(4-chlorophenyl)-1-[(1-phenyltriazole-4-carbonyl)amino]ethyl]boronic acid (PubChem CID 155552083) has the molecular formula C17H16BClN4O3 and a molecular weight of 370.61 g/mol. Its IUPAC name is [(1R)-2-(4-chlorophenyl)-1-[(1-phenyltriazole-4-carbonyl)amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(4-chlorophenyl)-1-[(1-phenyltriazole-4-carbonyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 155552083 |
| Molecular Formula | C17H16BClN4O3 |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [(1R)-2-(4-chlorophenyl)-1-[(1-phenyltriazole-4-carbonyl)amino]ethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(Cl)cc1)B(O)O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H16BClN4O3/c19-13-8-6-12(7-9-13)10-16(18(25)26)20-17(24)15-11-23(22-21-15)14-4-2-1-3-5-14/h1-9,11,16,25-26H,10H2,(H,20,24)/t16-/m0/s1 |
| InChIKey | HPURSNFBXSUXRD-INIZCTEOSA-N |
| XLogP | 1.27 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|