C14H19BN4O3 — CID 155554765
[(1R)-3-methyl-1-[(1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid (PubChem CID 155554765) has the molecular formula C14H19BN4O3 and a molecular weight of 302.14 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[(1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[(1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid |
|---|---|
| PubChem CID | 155554765 |
| Molecular Formula | C14H19BN4O3 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(1R)-3-methyl-1-[(1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1cn(-c2ccccc2)nn1)B(O)O |
| InChI | InChI=1S/C14H19BN4O3/c1-10(2)8-13(15(21)22)16-14(20)12-9-19(18-17-12)11-6-4-3-5-7-11/h3-7,9-10,13,21-22H,8H2,1-2H3,(H,16,20)/t13-/m0/s1 |
| InChIKey | IHGSYSKPSPTWGD-ZDUSSCGKSA-N |
| XLogP | 0.42 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|