C20H25F2N5O — CID 134218714
N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)triazole-4-carboxamide (PubChem CID 134218714) has the molecular formula C20H25F2N5O and a molecular weight of 389.45 g/mol. Its IUPAC name is N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)triazole-4-carboxamide.
| Compound Name | N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 134218714 |
| Molecular Formula | C20H25F2N5O |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)triazole-4-carboxamide |
| SMILES | O=C(NC1CCN(C2CCCCC2)CC1)c1cn(-c2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C20H25F2N5O/c21-14-6-7-19(17(22)12-14)27-13-18(24-25-27)20(28)23-15-8-10-26(11-9-15)16-4-2-1-3-5-16/h6-7,12-13,15-16H,1-5,8-11H2,(H,23,28) |
| InChIKey | LXPUDIQBEGHYOY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |