C21H26F2N4O — CID 162648130
N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)pyrazole-4-carboxamide (PubChem CID 162648130) has the molecular formula C21H26F2N4O and a molecular weight of 388.46 g/mol. Its IUPAC name is N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162648130 |
| Molecular Formula | C21H26F2N4O |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-(1-cyclohexylpiperidin-4-yl)-1-(2,4-difluorophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCN(C2CCCCC2)CC1)c1cnn(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C21H26F2N4O/c22-16-6-7-20(19(23)12-16)27-14-15(13-24-27)21(28)25-17-8-10-26(11-9-17)18-4-2-1-3-5-18/h6-7,12-14,17-18H,1-5,8-11H2,(H,25,28) |
| InChIKey | BIQOJTRPLHCSNS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |