C15H21BN4O3 — CID 155511095
[(1R)-3-methyl-1-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid (PubChem CID 155511095) has the molecular formula C15H21BN4O3 and a molecular weight of 316.17 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid |
|---|---|
| PubChem CID | 155511095 |
| Molecular Formula | C15H21BN4O3 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1R)-3-methyl-1-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]butyl]boronic acid |
| SMILES | Cc1c(C(=O)N[C@@H](CC(C)C)B(O)O)nnn1-c1ccccc1 |
| InChI | InChI=1S/C15H21BN4O3/c1-10(2)9-13(16(22)23)17-15(21)14-11(3)20(19-18-14)12-7-5-4-6-8-12/h4-8,10,13,22-23H,9H2,1-3H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | GFMNVWASCVSUEJ-ZDUSSCGKSA-N |
| XLogP | 0.73 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|