C16H23BN4O3 — CID 155534083
[(1R)-1-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid (PubChem CID 155534083) has the molecular formula C16H23BN4O3 and a molecular weight of 330.20 g/mol. Its IUPAC name is [(1R)-1-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 155534083 |
| Molecular Formula | C16H23BN4O3 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(1R)-1-[(1-benzyl-5-methyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid |
| SMILES | Cc1c(C(=O)N[C@@H](CC(C)C)B(O)O)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C16H23BN4O3/c1-11(2)9-14(17(23)24)18-16(22)15-12(3)21(20-19-15)10-13-7-5-4-6-8-13/h4-8,11,14,23-24H,9-10H2,1-3H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | KYQXFSIZVKGSKP-AWEZNQCLSA-N |
| XLogP | 0.79 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|