C11H12N4O — CID 18526204
1-benzyl-5-methyltriazole-4-carboxamide (PubChem CID 18526204) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-benzyl-5-methyltriazole-4-carboxamide.
| Compound Name | 1-benzyl-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 18526204 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-benzyl-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(N)=O)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C11H12N4O/c1-8-10(11(12)16)13-14-15(8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,12,16) |
| InChIKey | AROOFEHOERSTIR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |