C22H21NO6 — CID 155554622
2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-N-[(3S)-2-oxooxolan-3-yl]acetamide (PubChem CID 155554622) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-N-[(3S)-2-oxooxolan-3-yl]acetamide.
| Compound Name | 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-N-[(3S)-2-oxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 155554622 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-N-[(3S)-2-oxooxolan-3-yl]acetamide |
| SMILES | COc1ccccc1/C=C/C(=O)c1ccc(OCC(=O)N[C@H]2CCOC2=O)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-27-20-5-3-2-4-16(20)8-11-19(24)15-6-9-17(10-7-15)29-14-21(25)23-18-12-13-28-22(18)26/h2-11,18H,12-14H2,1H3,(H,23,25)/b11-8+/t18-/m0/s1 |
| InChIKey | SKBZWSCGKALHGD-MZEUMTGBSA-N |
| XLogP | 2.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|