C20H17FN2O2 — CID 155555011
N-[2-(2-fluorophenyl)ethyl]-5-(3-hydroxyphenyl)pyridine-2-carboxamide (PubChem CID 155555011) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5-(3-hydroxyphenyl)pyridine-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5-(3-hydroxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155555011 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5-(3-hydroxyphenyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1ccc(-c2cccc(O)c2)cn1 |
| InChI | InChI=1S/C20H17FN2O2/c21-18-7-2-1-4-14(18)10-11-22-20(25)19-9-8-16(13-23-19)15-5-3-6-17(24)12-15/h1-9,12-13,24H,10-11H2,(H,22,25) |
| InChIKey | GCRWCEUCYLRTEU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |