C29H29N3O6 — CID 155555572
4-methyl-7-[[1-[7-(2-oxochromen-7-yl)oxyheptyl]triazol-4-yl]methoxy]chromen-2-one (PubChem CID 155555572) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-methyl-7-[[1-[7-(2-oxochromen-7-yl)oxyheptyl]triazol-4-yl]methoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[[1-[7-(2-oxochromen-7-yl)oxyheptyl]triazol-4-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 155555572 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 4-methyl-7-[[1-[7-(2-oxochromen-7-yl)oxyheptyl]triazol-4-yl]methoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3cn(CCCCCCCOc4ccc5ccc(=O)oc5c4)nn3)ccc12 |
| InChI | InChI=1S/C29H29N3O6/c1-20-15-29(34)38-27-17-24(10-11-25(20)27)36-19-22-18-32(31-30-22)13-5-3-2-4-6-14-35-23-9-7-21-8-12-28(33)37-26(21)16-23/h7-12,15-18H,2-6,13-14,19H2,1H3 |
| InChIKey | XLBDPKWXYDQXKS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 109.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|