C19H17ClN4 — CID 155556473
2-chloro-4-[N-ethyl-2-methyl-5-(1H-pyrazol-4-yl)anilino]benzonitrile (PubChem CID 155556473) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 2-chloro-4-[N-ethyl-2-methyl-5-(1H-pyrazol-4-yl)anilino]benzonitrile.
| Compound Name | 2-chloro-4-[N-ethyl-2-methyl-5-(1H-pyrazol-4-yl)anilino]benzonitrile |
|---|---|
| PubChem CID | 155556473 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-chloro-4-[N-ethyl-2-methyl-5-(1H-pyrazol-4-yl)anilino]benzonitrile |
| SMILES | CCN(c1ccc(C#N)c(Cl)c1)c1cc(-c2cn[nH]c2)ccc1C |
| InChI | InChI=1S/C19H17ClN4/c1-3-24(17-7-6-15(10-21)18(20)9-17)19-8-14(5-4-13(19)2)16-11-22-23-12-16/h4-9,11-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | QFEXBMBQMXVSBB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|