C21H21ClN4 — CID 155331595
2-chloro-4-[N,2-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)anilino]benzonitrile (PubChem CID 155331595) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-chloro-4-[N,2-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)anilino]benzonitrile.
| Compound Name | 2-chloro-4-[N,2-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)anilino]benzonitrile |
|---|---|
| PubChem CID | 155331595 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-chloro-4-[N,2-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)anilino]benzonitrile |
| SMILES | Cc1ccc(-c2c(C)nn(C)c2C)cc1N(C)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClN4/c1-13-6-7-16(21-14(2)24-26(5)15(21)3)10-20(13)25(4)18-9-8-17(12-23)19(22)11-18/h6-11H,1-5H3 |
| InChIKey | KRYWDJDDCCHJIM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|