C20H20ClN3 — CID 143770009
2-chloro-4-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3,5-dimethylpyrazol-4-yl]benzonitrile (PubChem CID 143770009) has the molecular formula C20H20ClN3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-chloro-4-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3,5-dimethylpyrazol-4-yl]benzonitrile.
| Compound Name | 2-chloro-4-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3,5-dimethylpyrazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 143770009 |
| Molecular Formula | C20H20ClN3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-chloro-4-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3,5-dimethylpyrazol-4-yl]benzonitrile |
| SMILES | C=C/C(=C\C=C/C)Cn1nc(C)c(-c2ccc(C#N)c(Cl)c2)c1C |
| InChI | InChI=1S/C20H20ClN3/c1-5-7-8-16(6-2)13-24-15(4)20(14(3)23-24)17-9-10-18(12-22)19(21)11-17/h5-11H,2,13H2,1,3-4H3/b7-5-,16-8+ |
| InChIKey | ODNDQBBKAMUJGM-ACKKYSEPSA-N |
| XLogP | 5.38 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|