C22H27ClN4 — CID 143770032
butane;2-chloro-4-[3,5-dimethyl-1-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazol-4-yl]benzonitrile (PubChem CID 143770032) has the molecular formula C22H27ClN4 and a molecular weight of 382.94 g/mol. Its IUPAC name is butane;2-chloro-4-[3,5-dimethyl-1-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazol-4-yl]benzonitrile.
| Compound Name | butane;2-chloro-4-[3,5-dimethyl-1-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 143770032 |
| Molecular Formula | C22H27ClN4 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | butane;2-chloro-4-[3,5-dimethyl-1-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]pyrazol-4-yl]benzonitrile |
| SMILES | C=C/C=C(/Cn1nc(C)c(-c2ccc(C#N)c(Cl)c2)c1C)N=C.CCCC |
| InChI | InChI=1S/C18H17ClN4.C4H10/c1-5-6-16(21-4)11-23-13(3)18(12(2)22-23)14-7-8-15(10-20)17(19)9-14;1-3-4-2/h5-9H,1,4,11H2,2-3H3;3-4H2,1-2H3/b16-6-; |
| InChIKey | DUPYMJCQZFDTEK-NKBLJONXSA-N |
| XLogP | 6.27 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|