C22H22ClN5 — CID 175265520
4-[1-[(6-butanimidoyl-3-pyridinyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-chlorobenzonitrile (PubChem CID 175265520) has the molecular formula C22H22ClN5 and a molecular weight of 391.91 g/mol. Its IUPAC name is 4-[1-[(6-butanimidoyl-3-pyridinyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-chlorobenzonitrile.
| Compound Name | 4-[1-[(6-butanimidoyl-3-pyridinyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 175265520 |
| Molecular Formula | C22H22ClN5 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[1-[(6-butanimidoyl-3-pyridinyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-chlorobenzonitrile |
| SMILES | [H]/N=C(\CCC)c1ccc(Cn2nc(C)c(-c3ccc(C#N)c(Cl)c3)c2C)cn1 |
| InChI | InChI=1S/C22H22ClN5/c1-4-5-20(25)21-9-6-16(12-26-21)13-28-15(3)22(14(2)27-28)17-7-8-18(11-24)19(23)10-17/h6-10,12,25H,4-5,13H2,1-3H3/b25-20+ |
| InChIKey | CAQTWXIQSPEGKU-LKUDQCMESA-N |
| XLogP | 5.30 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|