C22H24F2N4 — CID 155556788
1,4-bis[(4-fluorophenyl)methyl]-2-(imidazol-1-ylmethyl)piperazine (PubChem CID 155556788) has the molecular formula C22H24F2N4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1,4-bis[(4-fluorophenyl)methyl]-2-(imidazol-1-ylmethyl)piperazine.
| Compound Name | 1,4-bis[(4-fluorophenyl)methyl]-2-(imidazol-1-ylmethyl)piperazine |
|---|---|
| PubChem CID | 155556788 |
| Molecular Formula | C22H24F2N4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1,4-bis[(4-fluorophenyl)methyl]-2-(imidazol-1-ylmethyl)piperazine |
| SMILES | Fc1ccc(CN2CCN(Cc3ccc(F)cc3)C(Cn3ccnc3)C2)cc1 |
| InChI | InChI=1S/C22H24F2N4/c23-20-5-1-18(2-6-20)13-26-11-12-28(14-19-3-7-21(24)8-4-19)22(15-26)16-27-10-9-25-17-27/h1-10,17,22H,11-16H2 |
| InChIKey | UXWUFBABZCQQGQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |