C13H15BrN2O — CID 155557964
[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(3-bromophenyl)methanone (PubChem CID 155557964) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(3-bromophenyl)methanone.
| Compound Name | [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(3-bromophenyl)methanone |
|---|---|
| PubChem CID | 155557964 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-(3-bromophenyl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1C[C@@H]2CCN[C@@H]2C1 |
| InChI | InChI=1S/C13H15BrN2O/c14-11-3-1-2-9(6-11)13(17)16-7-10-4-5-15-12(10)8-16/h1-3,6,10,12,15H,4-5,7-8H2/t10-,12+/m0/s1 |
| InChIKey | VZGQUVHJGMTTLC-CMPLNLGQSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |