C17H22BrN2O+ — CID 157100215
(3-bromophenyl)-spiro[3-aza-8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylmethanone (PubChem CID 157100215) has the molecular formula C17H22BrN2O+ and a molecular weight of 350.28 g/mol. Its IUPAC name is (3-bromophenyl)-spiro[3-aza-8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylmethanone.
| Compound Name | (3-bromophenyl)-spiro[3-aza-8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylmethanone |
|---|---|
| PubChem CID | 157100215 |
| Molecular Formula | C17H22BrN2O+ |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (3-bromophenyl)-spiro[3-aza-8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-ylmethanone |
| SMILES | O=C(c1cccc(Br)c1)N1CC2CCC(C1)[N+]21CCCC1 |
| InChI | InChI=1S/C17H22BrN2O/c18-14-5-3-4-13(10-14)17(21)19-11-15-6-7-16(12-19)20(15)8-1-2-9-20/h3-5,10,15-16H,1-2,6-9,11-12H2/q+1 |
| InChIKey | SEHHLCDLMHQXAH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|