C17H13N3O3 — CID 155558267
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]quinoline-6-carboxamide (PubChem CID 155558267) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]quinoline-6-carboxamide.
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 155558267 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]quinoline-6-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(O)cc1O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H13N3O3/c21-14-5-3-13(16(22)9-14)10-19-20-17(23)12-4-6-15-11(8-12)2-1-7-18-15/h1-10,21-22H,(H,20,23)/b19-10- |
| InChIKey | SENJSEJCGXLHIK-GRSHGNNSSA-N |
| XLogP | 2.41 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|