C18H17N2O3+ — CID 137037301
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-4-(1-methylcyclopropyl)benzamide (PubChem CID 137037301) has the molecular formula C18H17N2O3+ and a molecular weight of 309.35 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-4-(1-methylcyclopropyl)benzamide.
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-4-(1-methylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 137037301 |
| Molecular Formula | C18H17N2O3+ |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-4-(1-methylcyclopropyl)benzamide |
| SMILES | CC1(c2ccc(C(=O)N/N=C\c3ccc(O)cc3O)cc2)[CH+]C1 |
| InChI | InChI=1S/C18H16N2O3/c1-18(8-9-18)14-5-2-12(3-6-14)17(23)20-19-11-13-4-7-15(21)10-16(13)22/h2-8,10-11H,9H2,1H3,(H2-,19,20,21,22,23)/p+1 |
| InChIKey | OZFBYTPBTGYYOA-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|