C24H24F3N3O2 — CID 155558663
N-cyclohexyl-4-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 155558663) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-cyclohexyl-4-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-4-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155558663 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-cyclohexyl-4-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | COc1cccc(-c2cn(-c3ccc(C(F)(F)F)cc3)nc2C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C24H24F3N3O2/c1-32-20-9-5-6-16(14-20)21-15-30(19-12-10-17(11-13-19)24(25,26)27)29-22(21)23(31)28-18-7-3-2-4-8-18/h5-6,9-15,18H,2-4,7-8H2,1H3,(H,28,31) |
| InChIKey | GFQFXZAZCAIOAW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |