C25H26F2N2O3 — CID 155558702
(E)-N-[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-cyclopropyl-4-(4-fluorophenyl)-4-oxobut-2-enamide (PubChem CID 155558702) has the molecular formula C25H26F2N2O3 and a molecular weight of 440.49 g/mol. Its IUPAC name is (E)-N-[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-cyclopropyl-4-(4-fluorophenyl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-cyclopropyl-4-(4-fluorophenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 155558702 |
| Molecular Formula | C25H26F2N2O3 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (E)-N-[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-cyclopropyl-4-(4-fluorophenyl)-4-oxobut-2-enamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccc(F)cc1)N(C(=O)/C=C/C(=O)c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C25H26F2N2O3/c1-25(2,3)28-24(32)23(17-6-10-19(27)11-7-17)29(20-12-13-20)22(31)15-14-21(30)16-4-8-18(26)9-5-16/h4-11,14-15,20,23H,12-13H2,1-3H3,(H,28,32)/b15-14+ |
| InChIKey | RSPCURGJZZDUBD-CCEZHUSRSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|