C33H38N10O2 — CID 155559005
1-[4-[[2-[4-(4-but-3-ynylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 155559005) has the molecular formula C33H38N10O2 and a molecular weight of 606.74 g/mol. Its IUPAC name is 1-[4-[[2-[4-(4-but-3-ynylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[2-[4-(4-but-3-ynylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155559005 |
| Molecular Formula | C33H38N10O2 |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 1-[4-[[2-[4-(4-but-3-ynylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C#CCCN1CCN(c2ccc(Nc3nc(OC4CCN(C(=O)C=C)CC4)c4c(-c5cncc(NC)n5)c[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C33H38N10O2/c1-4-6-13-41-16-18-42(19-17-41)24-9-7-23(8-10-24)37-33-39-31-30(26(20-36-31)27-21-35-22-28(34-3)38-27)32(40-33)45-25-11-14-43(15-12-25)29(44)5-2/h1,5,7-10,20-22,25H,2,6,11-19H2,3H3,(H,34,38)(H2,36,37,39,40) |
| InChIKey | HDTAJYMSOFSQAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|