C33H52N2O2 — CID 155559168
(1R,2R,4R,5R,6S,9R,10R,13R)-1,9,10,14,14,17-hexamethyl-6-[(2R)-2,6,6-trimethyloxan-2-yl]-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-4-ol (PubChem CID 155559168) has the molecular formula C33H52N2O2 and a molecular weight of 508.79 g/mol. Its IUPAC name is (1R,2R,4R,5R,6S,9R,10R,13R)-1,9,10,14,14,17-hexamethyl-6-[(2R)-2,6,6-trimethyloxan-2-yl]-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-4-ol.
| Compound Name | (1R,2R,4R,5R,6S,9R,10R,13R)-1,9,10,14,14,17-hexamethyl-6-[(2R)-2,6,6-trimethyloxan-2-yl]-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-4-ol |
|---|---|
| PubChem CID | 155559168 |
| Molecular Formula | C33H52N2O2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | (1R,2R,4R,5R,6S,9R,10R,13R)-1,9,10,14,14,17-hexamethyl-6-[(2R)-2,6,6-trimethyloxan-2-yl]-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-4-ol |
| SMILES | Cc1ncc2c(n1)C(C)(C)[C@@H]1CC[C@]3(C)[C@H](C[C@@H](O)[C@@H]4[C@@H]([C@@]5(C)CCCC(C)(C)O5)CC[C@]43C)[C@@]1(C)C2 |
| InChI | InChI=1S/C33H52N2O2/c1-20-34-19-21-18-30(6)24(29(4,5)27(21)35-20)12-16-31(7)25(30)17-23(36)26-22(11-15-32(26,31)8)33(9)14-10-13-28(2,3)37-33/h19,22-26,36H,10-18H2,1-9H3/t22-,23+,24-,25+,26-,30-,31+,32+,33+/m0/s1 |
| InChIKey | TXNUXKLJONJFDC-ZSYGMLCOSA-N |
| XLogP | 7.19 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |