C18H20N4O2 — CID 155559468
1-[4-[4-(3,6-dihydro-2H-pyran-4-yl)pyrimidin-2-yl]phenyl]-3-ethylurea (PubChem CID 155559468) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[4-[4-(3,6-dihydro-2H-pyran-4-yl)pyrimidin-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[4-(3,6-dihydro-2H-pyran-4-yl)pyrimidin-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 155559468 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[4-[4-(3,6-dihydro-2H-pyran-4-yl)pyrimidin-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(-c2nccc(C3=CCOCC3)n2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-19-18(23)21-15-5-3-14(4-6-15)17-20-10-7-16(22-17)13-8-11-24-12-9-13/h3-8,10H,2,9,11-12H2,1H3,(H2,19,21,23) |
| InChIKey | DDOFYTCIAAOFGR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |