C24H26N4O3 — CID 155561624
5-[4-(hydroxymethyl)piperidin-1-yl]-2-phenylmethoxy-N-pyridazin-4-ylbenzamide (PubChem CID 155561624) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[4-(hydroxymethyl)piperidin-1-yl]-2-phenylmethoxy-N-pyridazin-4-ylbenzamide.
| Compound Name | 5-[4-(hydroxymethyl)piperidin-1-yl]-2-phenylmethoxy-N-pyridazin-4-ylbenzamide |
|---|---|
| PubChem CID | 155561624 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-[4-(hydroxymethyl)piperidin-1-yl]-2-phenylmethoxy-N-pyridazin-4-ylbenzamide |
| SMILES | O=C(Nc1ccnnc1)c1cc(N2CCC(CO)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H26N4O3/c29-16-18-9-12-28(13-10-18)21-6-7-23(31-17-19-4-2-1-3-5-19)22(14-21)24(30)27-20-8-11-25-26-15-20/h1-8,11,14-15,18,29H,9-10,12-13,16-17H2,(H,25,27,30) |
| InChIKey | KEXNTDQOVSKRJI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|