C25H24FN3O4 — CID 18545453
4-[4-[[2-[(4-fluorophenyl)methoxy]benzoyl]amino]phenyl]piperazine-1-carboxylic acid (PubChem CID 18545453) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is 4-[4-[[2-[(4-fluorophenyl)methoxy]benzoyl]amino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[[2-[(4-fluorophenyl)methoxy]benzoyl]amino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 18545453 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[4-[[2-[(4-fluorophenyl)methoxy]benzoyl]amino]phenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)O)CC2)cc1)c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O4/c26-19-7-5-18(6-8-19)17-33-23-4-2-1-3-22(23)24(30)27-20-9-11-21(12-10-20)28-13-15-29(16-14-28)25(31)32/h1-12H,13-17H2,(H,27,30)(H,31,32) |
| InChIKey | OAHLJYBHRJBJEP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|