About methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate
methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate (PubChem CID 155561886) has the molecular formula C19H14N2O2
and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate.
Molecular Properties
| Compound Name | methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate |
| PubChem CID | 155561886 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nccc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C19H14N2O2/c1-23-19(22)13-8-6-12(7-9-13)17-18-15(10-11-20-17)14-4-2-3-5-16(14)21-18/h2-11,21H,1H3 |
| InChIKey | IGENONQJOYFFEK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate?
The IUPAC name of methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate (CID 155561886) is methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate.
What is the SMILES notation for methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate?
The canonical SMILES for methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate is COC(=O)c1ccc(-c2nccc3c2[nH]c2ccccc23)cc1.
What is the InChIKey of methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate?
The InChIKey is IGENONQJOYFFEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O2/c1-23-19(22)13-8-6-12(7-9-13)17-18-15(10-11-20-17)14-4-2-3-5-16(14)21-18/h2-11,21H,1H3.
What are the key properties of methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate?
methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate has a molecular weight of 302.33 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(9H-pyrido[3,4-b]indol-1-yl)benzoate is sourced from PubChem (CID 155561886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).