C32H35NO4S — CID 155561927
[4-(naphthalene-2-carbonylamino)phenyl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 155561927) has the molecular formula C32H35NO4S and a molecular weight of 529.70 g/mol. Its IUPAC name is [4-(naphthalene-2-carbonylamino)phenyl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [4-(naphthalene-2-carbonylamino)phenyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 155561927 |
| Molecular Formula | C32H35NO4S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [4-(naphthalene-2-carbonylamino)phenyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Oc2ccc(NC(=O)c3ccc4ccccc4c3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C32H35NO4S/c1-20(2)26-18-29(21(3)4)31(30(19-26)22(5)6)38(35,36)37-28-15-13-27(14-16-28)33-32(34)25-12-11-23-9-7-8-10-24(23)17-25/h7-22H,1-6H3,(H,33,34) |
| InChIKey | XTKFBIRQBZNNKC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|