C29H31ClN8O4 — CID 155561964
1-[4-[[5-chloro-4-(3-methoxy-4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 155561964) has the molecular formula C29H31ClN8O4 and a molecular weight of 591.07 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-(3-methoxy-4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-[[5-chloro-4-(3-methoxy-4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 155561964 |
| Molecular Formula | C29H31ClN8O4 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 1-[4-[[5-chloro-4-(3-methoxy-4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | COc1cc(NC(=O)NCc2ccncc2)ccc1Nc1ncc(Cl)c(Nc2ccc(N3CCOCC3)c(OC)c2)n1 |
| InChI | InChI=1S/C29H31ClN8O4/c1-40-25-15-21(35-29(39)33-17-19-7-9-31-10-8-19)3-5-23(25)36-28-32-18-22(30)27(37-28)34-20-4-6-24(26(16-20)41-2)38-11-13-42-14-12-38/h3-10,15-16,18H,11-14,17H2,1-2H3,(H2,33,35,39)(H2,32,34,36,37) |
| InChIKey | WOKJHDPWCXLFQN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|