C29H43N5O6S — CID 155562027
N-[(3R,6R,9R,12R,15S)-3-benzyl-12-methyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide (PubChem CID 155562027) has the molecular formula C29H43N5O6S and a molecular weight of 589.76 g/mol. Its IUPAC name is N-[(3R,6R,9R,12R,15S)-3-benzyl-12-methyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide.
| Compound Name | N-[(3R,6R,9R,12R,15S)-3-benzyl-12-methyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide |
|---|---|
| PubChem CID | 155562027 |
| Molecular Formula | C29H43N5O6S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | N-[(3R,6R,9R,12R,15S)-3-benzyl-12-methyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CSC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C29H43N5O6S/c1-16(2)12-21-26(37)33-22(13-17(3)4)27(38)34-23(14-20-10-8-7-9-11-20)29(40)41-15-24(31-19(6)35)28(39)30-18(5)25(36)32-21/h7-11,16-18,21-24H,12-15H2,1-6H3,(H,30,39)(H,31,35)(H,32,36)(H,33,37)(H,34,38)/t18-,21-,22-,23-,24-/m1/s1 |
| InChIKey | MXGDTWRSRJXOIG-YHBXUWTPSA-N |
| XLogP | 1.06 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|